C14H10N2O3S2 — CID 80722215
5-amino-2-(thieno[3,2-b]thiophene-5-carbonylamino)benzoic acid (PubChem CID 80722215) has the molecular formula C14H10N2O3S2 and a molecular weight of 318.38 g/mol. Its IUPAC name is 5-amino-2-(thieno[3,2-b]thiophene-5-carbonylamino)benzoic acid.
| Compound Name | 5-amino-2-(thieno[3,2-b]thiophene-5-carbonylamino)benzoic acid |
|---|---|
| PubChem CID | 80722215 |
| Molecular Formula | C14H10N2O3S2 |
| Molecular Weight | 318.38 g/mol |
| Exact Mass | 318.01 |
| IUPAC Name | 5-amino-2-(thieno[3,2-b]thiophene-5-carbonylamino)benzoic acid |
| SMILES | Nc1ccc(NC(=O)c2cc3sccc3s2)c(C(=O)O)c1 |
| InChI | InChI=1S/C14H10N2O3S2/c15-7-1-2-9(8(5-7)14(18)19)16-13(17)12-6-11-10(21-12)3-4-20-11/h1-6H,15H2,(H,16,17)(H,18,19) |
| InChIKey | QHMXAUWXJVPJFP-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.38 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|