About 2-methyl-4-(thieno[3,2-b]thiophene-5-carbonylamino)benzoic acid
2-methyl-4-(thieno[3,2-b]thiophene-5-carbonylamino)benzoic acid (PubChem CID 80722535) has the molecular formula C15H11NO3S2
and a molecular weight of 317.39 g/mol. Its IUPAC name is 2-methyl-4-(thieno[3,2-b]thiophene-5-carbonylamino)benzoic acid.
Molecular Properties
| Compound Name | 2-methyl-4-(thieno[3,2-b]thiophene-5-carbonylamino)benzoic acid |
| PubChem CID | 80722535 |
| Molecular Formula | C15H11NO3S2 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.02 |
| IUPAC Name | 2-methyl-4-(thieno[3,2-b]thiophene-5-carbonylamino)benzoic acid |
| SMILES | Cc1cc(NC(=O)c2cc3sccc3s2)ccc1C(=O)O |
| InChI | InChI=1S/C15H11NO3S2/c1-8-6-9(2-3-10(8)15(18)19)16-14(17)13-7-12-11(21-13)4-5-20-12/h2-7H,1H3,(H,16,17)(H,18,19) |
| InChIKey | GONSWIVEMKLCRN-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-methyl-4-(thieno[3,2-b]thiophene-5-carbonylamino)benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-4-(thieno[3,2-b]thiophene-5-carbonylamino)benzoic acid?
The IUPAC name of 2-methyl-4-(thieno[3,2-b]thiophene-5-carbonylamino)benzoic acid (CID 80722535) is 2-methyl-4-(thieno[3,2-b]thiophene-5-carbonylamino)benzoic acid.
What is the SMILES notation for 2-methyl-4-(thieno[3,2-b]thiophene-5-carbonylamino)benzoic acid?
The canonical SMILES for 2-methyl-4-(thieno[3,2-b]thiophene-5-carbonylamino)benzoic acid is Cc1cc(NC(=O)c2cc3sccc3s2)ccc1C(=O)O.
What is the InChIKey of 2-methyl-4-(thieno[3,2-b]thiophene-5-carbonylamino)benzoic acid?
The InChIKey is GONSWIVEMKLCRN-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11NO3S2/c1-8-6-9(2-3-10(8)15(18)19)16-14(17)13-7-12-11(21-13)4-5-20-12/h2-7H,1H3,(H,16,17)(H,18,19).
What are the key properties of 2-methyl-4-(thieno[3,2-b]thiophene-5-carbonylamino)benzoic acid?
2-methyl-4-(thieno[3,2-b]thiophene-5-carbonylamino)benzoic acid has a molecular weight of 317.39 g/mol, XLogP of 4.22, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-4-(thieno[3,2-b]thiophene-5-carbonylamino)benzoic acid is sourced from PubChem (CID 80722535), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).