C14H8N2OS2 — CID 112733183
N-(3-cyanophenyl)thieno[3,2-b]thiophene-5-carboxamide (PubChem CID 112733183) has the molecular formula C14H8N2OS2 and a molecular weight of 284.37 g/mol. Its IUPAC name is N-(3-cyanophenyl)thieno[3,2-b]thiophene-5-carboxamide.
| Compound Name | N-(3-cyanophenyl)thieno[3,2-b]thiophene-5-carboxamide |
|---|---|
| PubChem CID | 112733183 |
| Molecular Formula | C14H8N2OS2 |
| Molecular Weight | 284.37 g/mol |
| Exact Mass | 284.01 |
| IUPAC Name | N-(3-cyanophenyl)thieno[3,2-b]thiophene-5-carboxamide |
| SMILES | N#Cc1cccc(NC(=O)c2cc3sccc3s2)c1 |
| InChI | InChI=1S/C14H8N2OS2/c15-8-9-2-1-3-10(6-9)16-14(17)13-7-12-11(19-13)4-5-18-12/h1-7H,(H,16,17) |
| InChIKey | SLEMBMBJAYEYGD-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.37 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |