C13H8ClNO2S2 — CID 78955049
N-(3-chloro-4-hydroxyphenyl)thieno[3,2-b]thiophene-5-carboxamide (PubChem CID 78955049) has the molecular formula C13H8ClNO2S2 and a molecular weight of 309.80 g/mol. Its IUPAC name is N-(3-chloro-4-hydroxyphenyl)thieno[3,2-b]thiophene-5-carboxamide.
| Compound Name | N-(3-chloro-4-hydroxyphenyl)thieno[3,2-b]thiophene-5-carboxamide |
|---|---|
| PubChem CID | 78955049 |
| Molecular Formula | C13H8ClNO2S2 |
| Molecular Weight | 309.80 g/mol |
| Exact Mass | 308.97 |
| IUPAC Name | N-(3-chloro-4-hydroxyphenyl)thieno[3,2-b]thiophene-5-carboxamide |
| SMILES | O=C(Nc1ccc(O)c(Cl)c1)c1cc2sccc2s1 |
| InChI | InChI=1S/C13H8ClNO2S2/c14-8-5-7(1-2-9(8)16)15-13(17)12-6-11-10(19-12)3-4-18-11/h1-6,16H,(H,15,17) |
| InChIKey | DIHNHDRWHNHLCQ-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.80 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|