C13H8BrNOS2 — CID 112733182
N-(3-bromophenyl)thieno[3,2-b]thiophene-5-carboxamide (PubChem CID 112733182) has the molecular formula C13H8BrNOS2 and a molecular weight of 338.25 g/mol. Its IUPAC name is N-(3-bromophenyl)thieno[3,2-b]thiophene-5-carboxamide.
| Compound Name | N-(3-bromophenyl)thieno[3,2-b]thiophene-5-carboxamide |
|---|---|
| PubChem CID | 112733182 |
| Molecular Formula | C13H8BrNOS2 |
| Molecular Weight | 338.25 g/mol |
| Exact Mass | 336.92 |
| IUPAC Name | N-(3-bromophenyl)thieno[3,2-b]thiophene-5-carboxamide |
| SMILES | O=C(Nc1cccc(Br)c1)c1cc2sccc2s1 |
| InChI | InChI=1S/C13H8BrNOS2/c14-8-2-1-3-9(6-8)15-13(16)12-7-11-10(18-12)4-5-17-11/h1-7H,(H,15,16) |
| InChIKey | AQRHSEYJLLLDTJ-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.25 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |