C19H14N2OS — CID 9192526
N-(3-cyanophenyl)-3-(4-methylphenyl)thiophene-2-carboxamide (PubChem CID 9192526) has the molecular formula C19H14N2OS and a molecular weight of 318.40 g/mol. Its IUPAC name is N-(3-cyanophenyl)-3-(4-methylphenyl)thiophene-2-carboxamide.
| Compound Name | N-(3-cyanophenyl)-3-(4-methylphenyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 9192526 |
| Molecular Formula | C19H14N2OS |
| Molecular Weight | 318.40 g/mol |
| Exact Mass | 318.08 |
| IUPAC Name | N-(3-cyanophenyl)-3-(4-methylphenyl)thiophene-2-carboxamide |
| SMILES | Cc1ccc(-c2ccsc2C(=O)Nc2cccc(C#N)c2)cc1 |
| InChI | InChI=1S/C19H14N2OS/c1-13-5-7-15(8-6-13)17-9-10-23-18(17)19(22)21-16-4-2-3-14(11-16)12-20/h2-11H,1H3,(H,21,22) |
| InChIKey | JZMWJRQLQRGURI-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.40 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |