C15H11NO3S2 — CID 80722706
5-methyl-2-(thieno[3,2-b]thiophene-5-carbonylamino)benzoic acid (PubChem CID 80722706) has the molecular formula C15H11NO3S2 and a molecular weight of 317.39 g/mol. Its IUPAC name is 5-methyl-2-(thieno[3,2-b]thiophene-5-carbonylamino)benzoic acid.
| Compound Name | 5-methyl-2-(thieno[3,2-b]thiophene-5-carbonylamino)benzoic acid |
|---|---|
| PubChem CID | 80722706 |
| Molecular Formula | C15H11NO3S2 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.02 |
| IUPAC Name | 5-methyl-2-(thieno[3,2-b]thiophene-5-carbonylamino)benzoic acid |
| SMILES | Cc1ccc(NC(=O)c2cc3sccc3s2)c(C(=O)O)c1 |
| InChI | InChI=1S/C15H11NO3S2/c1-8-2-3-10(9(6-8)15(18)19)16-14(17)13-7-12-11(21-13)4-5-20-12/h2-7H,1H3,(H,16,17)(H,18,19) |
| InChIKey | HKNBBWUAYLRVHD-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |