C13H11BrN2O3S — CID 79981158
5-amino-2-[(5-bromo-4-methylthiophene-2-carbonyl)amino]benzoic acid (PubChem CID 79981158) has the molecular formula C13H11BrN2O3S and a molecular weight of 355.21 g/mol. Its IUPAC name is 5-amino-2-[(5-bromo-4-methylthiophene-2-carbonyl)amino]benzoic acid.
| Compound Name | 5-amino-2-[(5-bromo-4-methylthiophene-2-carbonyl)amino]benzoic acid |
|---|---|
| PubChem CID | 79981158 |
| Molecular Formula | C13H11BrN2O3S |
| Molecular Weight | 355.21 g/mol |
| Exact Mass | 353.97 |
| IUPAC Name | 5-amino-2-[(5-bromo-4-methylthiophene-2-carbonyl)amino]benzoic acid |
| SMILES | Cc1cc(C(=O)Nc2ccc(N)cc2C(=O)O)sc1Br |
| InChI | InChI=1S/C13H11BrN2O3S/c1-6-4-10(20-11(6)14)12(17)16-9-3-2-7(15)5-8(9)13(18)19/h2-5H,15H2,1H3,(H,16,17)(H,18,19) |
| InChIKey | WAGZGNWZTDXPAS-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.21 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|