C12H6Br2INO3S — CID 63405667
2-[(4,5-dibromothiophene-2-carbonyl)amino]-5-iodobenzoic acid (PubChem CID 63405667) has the molecular formula C12H6Br2INO3S and a molecular weight of 530.96 g/mol. Its IUPAC name is 2-[(4,5-dibromothiophene-2-carbonyl)amino]-5-iodobenzoic acid.
| Compound Name | 2-[(4,5-dibromothiophene-2-carbonyl)amino]-5-iodobenzoic acid |
|---|---|
| PubChem CID | 63405667 |
| Molecular Formula | C12H6Br2INO3S |
| Molecular Weight | 530.96 g/mol |
| Exact Mass | 528.75 |
| IUPAC Name | 2-[(4,5-dibromothiophene-2-carbonyl)amino]-5-iodobenzoic acid |
| SMILES | O=C(Nc1ccc(I)cc1C(=O)O)c1cc(Br)c(Br)s1 |
| InChI | InChI=1S/C12H6Br2INO3S/c13-7-4-9(20-10(7)14)11(17)16-8-2-1-5(15)3-6(8)12(18)19/h1-4H,(H,16,17)(H,18,19) |
| InChIKey | USKVJXLHRBOAAF-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.96 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|