C13H9Br2NO3S — CID 43239573
3-[(4,5-dibromothiophene-2-carbonyl)amino]-4-methylbenzoic acid (PubChem CID 43239573) has the molecular formula C13H9Br2NO3S and a molecular weight of 419.09 g/mol. Its IUPAC name is 3-[(4,5-dibromothiophene-2-carbonyl)amino]-4-methylbenzoic acid.
| Compound Name | 3-[(4,5-dibromothiophene-2-carbonyl)amino]-4-methylbenzoic acid |
|---|---|
| PubChem CID | 43239573 |
| Molecular Formula | C13H9Br2NO3S |
| Molecular Weight | 419.09 g/mol |
| Exact Mass | 416.87 |
| IUPAC Name | 3-[(4,5-dibromothiophene-2-carbonyl)amino]-4-methylbenzoic acid |
| SMILES | Cc1ccc(C(=O)O)cc1NC(=O)c1cc(Br)c(Br)s1 |
| InChI | InChI=1S/C13H9Br2NO3S/c1-6-2-3-7(13(18)19)4-9(6)16-12(17)10-5-8(14)11(15)20-10/h2-5H,1H3,(H,16,17)(H,18,19) |
| InChIKey | JKNZWNPEVITVMY-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.09 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |