C15H15Br2NOS — CID 78906422
4,5-dibromo-N-(2-tert-butylphenyl)thiophene-2-carboxamide (PubChem CID 78906422) has the molecular formula C15H15Br2NOS and a molecular weight of 417.17 g/mol. Its IUPAC name is 4,5-dibromo-N-(2-tert-butylphenyl)thiophene-2-carboxamide.
| Compound Name | 4,5-dibromo-N-(2-tert-butylphenyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 78906422 |
| Molecular Formula | C15H15Br2NOS |
| Molecular Weight | 417.17 g/mol |
| Exact Mass | 414.92 |
| IUPAC Name | 4,5-dibromo-N-(2-tert-butylphenyl)thiophene-2-carboxamide |
| SMILES | CC(C)(C)c1ccccc1NC(=O)c1cc(Br)c(Br)s1 |
| InChI | InChI=1S/C15H15Br2NOS/c1-15(2,3)9-6-4-5-7-11(9)18-14(19)12-8-10(16)13(17)20-12/h4-8H,1-3H3,(H,18,19) |
| InChIKey | LBWRGFLZBQWWMP-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.17 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |