C12H8Br2FNOS — CID 42971041
4,5-dibromo-N-(2-fluoro-5-methylphenyl)thiophene-2-carboxamide (PubChem CID 42971041) has the molecular formula C12H8Br2FNOS and a molecular weight of 393.08 g/mol. Its IUPAC name is 4,5-dibromo-N-(2-fluoro-5-methylphenyl)thiophene-2-carboxamide.
| Compound Name | 4,5-dibromo-N-(2-fluoro-5-methylphenyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 42971041 |
| Molecular Formula | C12H8Br2FNOS |
| Molecular Weight | 393.08 g/mol |
| Exact Mass | 390.87 |
| IUPAC Name | 4,5-dibromo-N-(2-fluoro-5-methylphenyl)thiophene-2-carboxamide |
| SMILES | Cc1ccc(F)c(NC(=O)c2cc(Br)c(Br)s2)c1 |
| InChI | InChI=1S/C12H8Br2FNOS/c1-6-2-3-8(15)9(4-6)16-12(17)10-5-7(13)11(14)18-10/h2-5H,1H3,(H,16,17) |
| InChIKey | MIFCXTRYJBSHJP-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.08 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |