C15H15Br2NO2S — CID 80534122
4,5-dibromo-N-(4-methyl-2-propoxyphenyl)thiophene-2-carboxamide (PubChem CID 80534122) has the molecular formula C15H15Br2NO2S and a molecular weight of 433.17 g/mol. Its IUPAC name is 4,5-dibromo-N-(4-methyl-2-propoxyphenyl)thiophene-2-carboxamide.
| Compound Name | 4,5-dibromo-N-(4-methyl-2-propoxyphenyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 80534122 |
| Molecular Formula | C15H15Br2NO2S |
| Molecular Weight | 433.17 g/mol |
| Exact Mass | 430.92 |
| IUPAC Name | 4,5-dibromo-N-(4-methyl-2-propoxyphenyl)thiophene-2-carboxamide |
| SMILES | CCCOc1cc(C)ccc1NC(=O)c1cc(Br)c(Br)s1 |
| InChI | InChI=1S/C15H15Br2NO2S/c1-3-6-20-12-7-9(2)4-5-11(12)18-15(19)13-8-10(16)14(17)21-13/h4-5,7-8H,3,6H2,1-2H3,(H,18,19) |
| InChIKey | NBOFDYPKKWCNHR-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.17 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |