C16H16Cl2N2O2 — CID 87023490
2,6-dichloro-N-(4-methyl-2-propoxyphenyl)pyridine-4-carboxamide (PubChem CID 87023490) has the molecular formula C16H16Cl2N2O2 and a molecular weight of 339.22 g/mol. Its IUPAC name is 2,6-dichloro-N-(4-methyl-2-propoxyphenyl)pyridine-4-carboxamide.
| Compound Name | 2,6-dichloro-N-(4-methyl-2-propoxyphenyl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 87023490 |
| Molecular Formula | C16H16Cl2N2O2 |
| Molecular Weight | 339.22 g/mol |
| Exact Mass | 338.06 |
| IUPAC Name | 2,6-dichloro-N-(4-methyl-2-propoxyphenyl)pyridine-4-carboxamide |
| SMILES | CCCOc1cc(C)ccc1NC(=O)c1cc(Cl)nc(Cl)c1 |
| InChI | InChI=1S/C16H16Cl2N2O2/c1-3-6-22-13-7-10(2)4-5-12(13)19-16(21)11-8-14(17)20-15(18)9-11/h4-5,7-9H,3,6H2,1-2H3,(H,19,21) |
| InChIKey | OOQDDCKBLPDDNF-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.22 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|