C14H17N3O3 — CID 60934173
N-[2-(2-methoxyethoxy)-4-methylphenyl]-1H-pyrazole-4-carboxamide (PubChem CID 60934173) has the molecular formula C14H17N3O3 and a molecular weight of 275.31 g/mol. Its IUPAC name is N-[2-(2-methoxyethoxy)-4-methylphenyl]-1H-pyrazole-4-carboxamide.
| Compound Name | N-[2-(2-methoxyethoxy)-4-methylphenyl]-1H-pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 60934173 |
| Molecular Formula | C14H17N3O3 |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | N-[2-(2-methoxyethoxy)-4-methylphenyl]-1H-pyrazole-4-carboxamide |
| SMILES | COCCOc1cc(C)ccc1NC(=O)c1cn[nH]c1 |
| InChI | InChI=1S/C14H17N3O3/c1-10-3-4-12(13(7-10)20-6-5-19-2)17-14(18)11-8-15-16-9-11/h3-4,7-9H,5-6H2,1-2H3,(H,15,16)(H,17,18) |
| InChIKey | LOXTUAWCSIXURT-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 76.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|