C18H18F3NO4 — CID 55891215
N-[2-(2-methoxyethoxy)-4-methylphenyl]-4-(trifluoromethoxy)benzamide (PubChem CID 55891215) has the molecular formula C18H18F3NO4 and a molecular weight of 369.34 g/mol. Its IUPAC name is N-[2-(2-methoxyethoxy)-4-methylphenyl]-4-(trifluoromethoxy)benzamide.
| Compound Name | N-[2-(2-methoxyethoxy)-4-methylphenyl]-4-(trifluoromethoxy)benzamide |
|---|---|
| PubChem CID | 55891215 |
| Molecular Formula | C18H18F3NO4 |
| Molecular Weight | 369.34 g/mol |
| Exact Mass | 369.12 |
| IUPAC Name | N-[2-(2-methoxyethoxy)-4-methylphenyl]-4-(trifluoromethoxy)benzamide |
| SMILES | COCCOc1cc(C)ccc1NC(=O)c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C18H18F3NO4/c1-12-3-8-15(16(11-12)25-10-9-24-2)22-17(23)13-4-6-14(7-5-13)26-18(19,20)21/h3-8,11H,9-10H2,1-2H3,(H,22,23) |
| InChIKey | VRZHAYZMZNAKQK-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.34 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|