C16H17N3O5 — CID 120685047
5-[[2-(2-methoxyethoxy)-4-methylphenyl]carbamoyl]pyrazine-2-carboxylic acid (PubChem CID 120685047) has the molecular formula C16H17N3O5 and a molecular weight of 331.33 g/mol. Its IUPAC name is 5-[[2-(2-methoxyethoxy)-4-methylphenyl]carbamoyl]pyrazine-2-carboxylic acid.
| Compound Name | 5-[[2-(2-methoxyethoxy)-4-methylphenyl]carbamoyl]pyrazine-2-carboxylic acid |
|---|---|
| PubChem CID | 120685047 |
| Molecular Formula | C16H17N3O5 |
| Molecular Weight | 331.33 g/mol |
| Exact Mass | 331.12 |
| IUPAC Name | 5-[[2-(2-methoxyethoxy)-4-methylphenyl]carbamoyl]pyrazine-2-carboxylic acid |
| SMILES | COCCOc1cc(C)ccc1NC(=O)c1cnc(C(=O)O)cn1 |
| InChI | InChI=1S/C16H17N3O5/c1-10-3-4-11(14(7-10)24-6-5-23-2)19-15(20)12-8-18-13(9-17-12)16(21)22/h3-4,7-9H,5-6H2,1-2H3,(H,19,20)(H,21,22) |
| InChIKey | UJRPUYLNLUIFIG-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 110.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.33 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|