C16H17ClN2O2 — CID 62233815
6-chloro-N-(4-methyl-2-propoxyphenyl)pyridine-2-carboxamide (PubChem CID 62233815) has the molecular formula C16H17ClN2O2 and a molecular weight of 304.78 g/mol. Its IUPAC name is 6-chloro-N-(4-methyl-2-propoxyphenyl)pyridine-2-carboxamide.
| Compound Name | 6-chloro-N-(4-methyl-2-propoxyphenyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 62233815 |
| Molecular Formula | C16H17ClN2O2 |
| Molecular Weight | 304.78 g/mol |
| Exact Mass | 304.10 |
| IUPAC Name | 6-chloro-N-(4-methyl-2-propoxyphenyl)pyridine-2-carboxamide |
| SMILES | CCCOc1cc(C)ccc1NC(=O)c1cccc(Cl)n1 |
| InChI | InChI=1S/C16H17ClN2O2/c1-3-9-21-14-10-11(2)7-8-12(14)19-16(20)13-5-4-6-15(17)18-13/h4-8,10H,3,9H2,1-2H3,(H,19,20) |
| InChIKey | DCEIAGSCNZVXDJ-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.78 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|