C14H13Br2NO2S — CID 39498025
4,5-dibromo-N-(2-propan-2-yloxyphenyl)thiophene-2-carboxamide (PubChem CID 39498025) has the molecular formula C14H13Br2NO2S and a molecular weight of 419.14 g/mol. Its IUPAC name is 4,5-dibromo-N-(2-propan-2-yloxyphenyl)thiophene-2-carboxamide.
| Compound Name | 4,5-dibromo-N-(2-propan-2-yloxyphenyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 39498025 |
| Molecular Formula | C14H13Br2NO2S |
| Molecular Weight | 419.14 g/mol |
| Exact Mass | 416.90 |
| IUPAC Name | 4,5-dibromo-N-(2-propan-2-yloxyphenyl)thiophene-2-carboxamide |
| SMILES | CC(C)Oc1ccccc1NC(=O)c1cc(Br)c(Br)s1 |
| InChI | InChI=1S/C14H13Br2NO2S/c1-8(2)19-11-6-4-3-5-10(11)17-14(18)12-7-9(15)13(16)20-12/h3-8H,1-2H3,(H,17,18) |
| InChIKey | FUMWUQMEWIKFAU-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.14 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |