C12H7Br2ClN2O2S — CID 78954012
4,5-dibromo-N-(5-carbamoyl-2-chlorophenyl)thiophene-2-carboxamide (PubChem CID 78954012) has the molecular formula C12H7Br2ClN2O2S and a molecular weight of 438.53 g/mol. Its IUPAC name is 4,5-dibromo-N-(5-carbamoyl-2-chlorophenyl)thiophene-2-carboxamide.
| Compound Name | 4,5-dibromo-N-(5-carbamoyl-2-chlorophenyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 78954012 |
| Molecular Formula | C12H7Br2ClN2O2S |
| Molecular Weight | 438.53 g/mol |
| Exact Mass | 435.83 |
| IUPAC Name | 4,5-dibromo-N-(5-carbamoyl-2-chlorophenyl)thiophene-2-carboxamide |
| SMILES | NC(=O)c1ccc(Cl)c(NC(=O)c2cc(Br)c(Br)s2)c1 |
| InChI | InChI=1S/C12H7Br2ClN2O2S/c13-6-4-9(20-10(6)14)12(19)17-8-3-5(11(16)18)1-2-7(8)15/h1-4H,(H2,16,18)(H,17,19) |
| InChIKey | YJFCQMJMGDYSKO-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.53 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |