C12H13N3O2S — CID 65199378
N-(2-amino-4-methoxyphenyl)-2-methyl-1,3-thiazole-4-carboxamide (PubChem CID 65199378) has the molecular formula C12H13N3O2S and a molecular weight of 263.32 g/mol. Its IUPAC name is N-(2-amino-4-methoxyphenyl)-2-methyl-1,3-thiazole-4-carboxamide.
| Compound Name | N-(2-amino-4-methoxyphenyl)-2-methyl-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 65199378 |
| Molecular Formula | C12H13N3O2S |
| Molecular Weight | 263.32 g/mol |
| Exact Mass | 263.07 |
| IUPAC Name | N-(2-amino-4-methoxyphenyl)-2-methyl-1,3-thiazole-4-carboxamide |
| SMILES | COc1ccc(NC(=O)c2csc(C)n2)c(N)c1 |
| InChI | InChI=1S/C12H13N3O2S/c1-7-14-11(6-18-7)12(16)15-10-4-3-8(17-2)5-9(10)13/h3-6H,13H2,1-2H3,(H,15,16) |
| InChIKey | XUJWTDODIQPCQQ-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.32 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|