C12H13N3OS — CID 65199836
N-(3-amino-4-methylphenyl)-2-methyl-1,3-thiazole-4-carboxamide (PubChem CID 65199836) has the molecular formula C12H13N3OS and a molecular weight of 247.32 g/mol. Its IUPAC name is N-(3-amino-4-methylphenyl)-2-methyl-1,3-thiazole-4-carboxamide.
| Compound Name | N-(3-amino-4-methylphenyl)-2-methyl-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 65199836 |
| Molecular Formula | C12H13N3OS |
| Molecular Weight | 247.32 g/mol |
| Exact Mass | 247.08 |
| IUPAC Name | N-(3-amino-4-methylphenyl)-2-methyl-1,3-thiazole-4-carboxamide |
| SMILES | Cc1nc(C(=O)Nc2ccc(C)c(N)c2)cs1 |
| InChI | InChI=1S/C12H13N3OS/c1-7-3-4-9(5-10(7)13)15-12(16)11-6-17-8(2)14-11/h3-6H,13H2,1-2H3,(H,15,16) |
| InChIKey | OJOMRVXNINWELS-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.32 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|