C15H13N3O2S — CID 86883645
N-(2-methoxyquinolin-6-yl)-2-methyl-1,3-thiazole-4-carboxamide (PubChem CID 86883645) has the molecular formula C15H13N3O2S and a molecular weight of 299.36 g/mol. Its IUPAC name is N-(2-methoxyquinolin-6-yl)-2-methyl-1,3-thiazole-4-carboxamide.
| Compound Name | N-(2-methoxyquinolin-6-yl)-2-methyl-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 86883645 |
| Molecular Formula | C15H13N3O2S |
| Molecular Weight | 299.36 g/mol |
| Exact Mass | 299.07 |
| IUPAC Name | N-(2-methoxyquinolin-6-yl)-2-methyl-1,3-thiazole-4-carboxamide |
| SMILES | COc1ccc2cc(NC(=O)c3csc(C)n3)ccc2n1 |
| InChI | InChI=1S/C15H13N3O2S/c1-9-16-13(8-21-9)15(19)17-11-4-5-12-10(7-11)3-6-14(18-12)20-2/h3-8H,1-2H3,(H,17,19) |
| InChIKey | IRHQAXHEPBVYJT-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.36 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |