C11H10ClN3OS — CID 82861418
N-(4-amino-3-chlorophenyl)-2-methyl-1,3-thiazole-4-carboxamide (PubChem CID 82861418) has the molecular formula C11H10ClN3OS and a molecular weight of 267.74 g/mol. Its IUPAC name is N-(4-amino-3-chlorophenyl)-2-methyl-1,3-thiazole-4-carboxamide.
| Compound Name | N-(4-amino-3-chlorophenyl)-2-methyl-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 82861418 |
| Molecular Formula | C11H10ClN3OS |
| Molecular Weight | 267.74 g/mol |
| Exact Mass | 267.02 |
| IUPAC Name | N-(4-amino-3-chlorophenyl)-2-methyl-1,3-thiazole-4-carboxamide |
| SMILES | Cc1nc(C(=O)Nc2ccc(N)c(Cl)c2)cs1 |
| InChI | InChI=1S/C11H10ClN3OS/c1-6-14-10(5-17-6)11(16)15-7-2-3-9(13)8(12)4-7/h2-5H,13H2,1H3,(H,15,16) |
| InChIKey | GMRXYHRTGAOMES-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.74 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|