C13H10Cl2N2O3S — CID 116697597
ethyl 4-[(3,4-dichlorophenyl)carbamoyl]-1,3-thiazole-2-carboxylate (PubChem CID 116697597) has the molecular formula C13H10Cl2N2O3S and a molecular weight of 345.21 g/mol. Its IUPAC name is ethyl 4-[(3,4-dichlorophenyl)carbamoyl]-1,3-thiazole-2-carboxylate.
| Compound Name | ethyl 4-[(3,4-dichlorophenyl)carbamoyl]-1,3-thiazole-2-carboxylate |
|---|---|
| PubChem CID | 116697597 |
| Molecular Formula | C13H10Cl2N2O3S |
| Molecular Weight | 345.21 g/mol |
| Exact Mass | 343.98 |
| IUPAC Name | ethyl 4-[(3,4-dichlorophenyl)carbamoyl]-1,3-thiazole-2-carboxylate |
| SMILES | CCOC(=O)c1nc(C(=O)Nc2ccc(Cl)c(Cl)c2)cs1 |
| InChI | InChI=1S/C13H10Cl2N2O3S/c1-2-20-13(19)12-17-10(6-21-12)11(18)16-7-3-4-8(14)9(15)5-7/h3-6H,2H2,1H3,(H,16,18) |
| InChIKey | OTUNEZICFNMABO-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.21 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |