C12H10N2O4S — CID 65199858
5-hydroxy-2-[(2-methyl-1,3-thiazole-4-carbonyl)amino]benzoic acid (PubChem CID 65199858) has the molecular formula C12H10N2O4S and a molecular weight of 278.29 g/mol. Its IUPAC name is 5-hydroxy-2-[(2-methyl-1,3-thiazole-4-carbonyl)amino]benzoic acid.
| Compound Name | 5-hydroxy-2-[(2-methyl-1,3-thiazole-4-carbonyl)amino]benzoic acid |
|---|---|
| PubChem CID | 65199858 |
| Molecular Formula | C12H10N2O4S |
| Molecular Weight | 278.29 g/mol |
| Exact Mass | 278.04 |
| IUPAC Name | 5-hydroxy-2-[(2-methyl-1,3-thiazole-4-carbonyl)amino]benzoic acid |
| SMILES | Cc1nc(C(=O)Nc2ccc(O)cc2C(=O)O)cs1 |
| InChI | InChI=1S/C12H10N2O4S/c1-6-13-10(5-19-6)11(16)14-9-3-2-7(15)4-8(9)12(17)18/h2-5,15H,1H3,(H,14,16)(H,17,18) |
| InChIKey | ZFTZYMRPKMIHPP-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 99.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.29 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anthranil_acid_F(2)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|