C15H14N2O4 — CID 62829376
2-[(2,6-dimethylpyridine-3-carbonyl)amino]-5-hydroxybenzoic acid (PubChem CID 62829376) has the molecular formula C15H14N2O4 and a molecular weight of 286.29 g/mol. Its IUPAC name is 2-[(2,6-dimethylpyridine-3-carbonyl)amino]-5-hydroxybenzoic acid.
| Compound Name | 2-[(2,6-dimethylpyridine-3-carbonyl)amino]-5-hydroxybenzoic acid |
|---|---|
| PubChem CID | 62829376 |
| Molecular Formula | C15H14N2O4 |
| Molecular Weight | 286.29 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | 2-[(2,6-dimethylpyridine-3-carbonyl)amino]-5-hydroxybenzoic acid |
| SMILES | Cc1ccc(C(=O)Nc2ccc(O)cc2C(=O)O)c(C)n1 |
| InChI | InChI=1S/C15H14N2O4/c1-8-3-5-11(9(2)16-8)14(19)17-13-6-4-10(18)7-12(13)15(20)21/h3-7,18H,1-2H3,(H,17,19)(H,20,21) |
| InChIKey | KXMDEIAHUAUGTJ-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 99.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.29 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anthranil_acid_F(2)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|