C10H9N5O4 — CID 62792673
2-[(3-amino-1H-1,2,4-triazole-5-carbonyl)amino]-5-hydroxybenzoic acid (PubChem CID 62792673) has the molecular formula C10H9N5O4 and a molecular weight of 263.21 g/mol. Its IUPAC name is 2-[(3-amino-1H-1,2,4-triazole-5-carbonyl)amino]-5-hydroxybenzoic acid.
| Compound Name | 2-[(3-amino-1H-1,2,4-triazole-5-carbonyl)amino]-5-hydroxybenzoic acid |
|---|---|
| PubChem CID | 62792673 |
| Molecular Formula | C10H9N5O4 |
| Molecular Weight | 263.21 g/mol |
| Exact Mass | 263.07 |
| IUPAC Name | 2-[(3-amino-1H-1,2,4-triazole-5-carbonyl)amino]-5-hydroxybenzoic acid |
| SMILES | Nc1n[nH]c(C(=O)Nc2ccc(O)cc2C(=O)O)n1 |
| InChI | InChI=1S/C10H9N5O4/c11-10-13-7(14-15-10)8(17)12-6-2-1-4(16)3-5(6)9(18)19/h1-3,16H,(H,12,17)(H,18,19)(H3,11,13,14,15) |
| InChIKey | NEXZUDKPQSQMFP-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 154.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.21 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|