C10H8N4O4 — CID 63652944
5-hydroxy-2-(1H-1,2,4-triazole-5-carbonylamino)benzoic acid (PubChem CID 63652944) has the molecular formula C10H8N4O4 and a molecular weight of 248.20 g/mol. Its IUPAC name is 5-hydroxy-2-(1H-1,2,4-triazole-5-carbonylamino)benzoic acid.
| Compound Name | 5-hydroxy-2-(1H-1,2,4-triazole-5-carbonylamino)benzoic acid |
|---|---|
| PubChem CID | 63652944 |
| Molecular Formula | C10H8N4O4 |
| Molecular Weight | 248.20 g/mol |
| Exact Mass | 248.05 |
| IUPAC Name | 5-hydroxy-2-(1H-1,2,4-triazole-5-carbonylamino)benzoic acid |
| SMILES | O=C(Nc1ccc(O)cc1C(=O)O)c1ncn[nH]1 |
| InChI | InChI=1S/C10H8N4O4/c15-5-1-2-7(6(3-5)10(17)18)13-9(16)8-11-4-12-14-8/h1-4,15H,(H,13,16)(H,17,18)(H,11,12,14) |
| InChIKey | UOYGIIOICFYTEW-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 128.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.20 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|