C9H8N4O2 — CID 755004
N-(2-hydroxyphenyl)-1H-1,2,4-triazole-5-carboxamide (PubChem CID 755004) has the molecular formula C9H8N4O2 and a molecular weight of 204.19 g/mol. Its IUPAC name is N-(2-hydroxyphenyl)-1H-1,2,4-triazole-5-carboxamide.
| Compound Name | N-(2-hydroxyphenyl)-1H-1,2,4-triazole-5-carboxamide |
|---|---|
| PubChem CID | 755004 |
| Molecular Formula | C9H8N4O2 |
| Molecular Weight | 204.19 g/mol |
| Exact Mass | 204.06 |
| IUPAC Name | N-(2-hydroxyphenyl)-1H-1,2,4-triazole-5-carboxamide |
| SMILES | O=C(Nc1ccccc1O)c1ncn[nH]1 |
| InChI | InChI=1S/C9H8N4O2/c14-7-4-2-1-3-6(7)12-9(15)8-10-5-11-13-8/h1-5,14H,(H,12,15)(H,10,11,13) |
| InChIKey | IYQUDUSTBMGBEP-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.19 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|