C9H6I2N4O — CID 71960344
N-(2,4-diiodophenyl)-1H-1,2,4-triazole-5-carboxamide (PubChem CID 71960344) has the molecular formula C9H6I2N4O and a molecular weight of 439.98 g/mol. Its IUPAC name is N-(2,4-diiodophenyl)-1H-1,2,4-triazole-5-carboxamide.
| Compound Name | N-(2,4-diiodophenyl)-1H-1,2,4-triazole-5-carboxamide |
|---|---|
| PubChem CID | 71960344 |
| Molecular Formula | C9H6I2N4O |
| Molecular Weight | 439.98 g/mol |
| Exact Mass | 439.86 |
| IUPAC Name | N-(2,4-diiodophenyl)-1H-1,2,4-triazole-5-carboxamide |
| SMILES | O=C(Nc1ccc(I)cc1I)c1ncn[nH]1 |
| InChI | InChI=1S/C9H6I2N4O/c10-5-1-2-7(6(11)3-5)14-9(16)8-12-4-13-15-8/h1-4H,(H,14,16)(H,12,13,15) |
| InChIKey | AEXODGFCTNKCMN-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.98 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|