C10H7IN4O3 — CID 63652241
5-iodo-2-(1H-1,2,4-triazole-5-carbonylamino)benzoic acid (PubChem CID 63652241) has the molecular formula C10H7IN4O3 and a molecular weight of 358.10 g/mol. Its IUPAC name is 5-iodo-2-(1H-1,2,4-triazole-5-carbonylamino)benzoic acid.
| Compound Name | 5-iodo-2-(1H-1,2,4-triazole-5-carbonylamino)benzoic acid |
|---|---|
| PubChem CID | 63652241 |
| Molecular Formula | C10H7IN4O3 |
| Molecular Weight | 358.10 g/mol |
| Exact Mass | 357.96 |
| IUPAC Name | 5-iodo-2-(1H-1,2,4-triazole-5-carbonylamino)benzoic acid |
| SMILES | O=C(Nc1ccc(I)cc1C(=O)O)c1ncn[nH]1 |
| InChI | InChI=1S/C10H7IN4O3/c11-5-1-2-7(6(3-5)10(17)18)14-9(16)8-12-4-13-15-8/h1-4H,(H,14,16)(H,17,18)(H,12,13,15) |
| InChIKey | XHVOPIPFSSYCIX-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.10 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|