C12H12N4O5 — CID 63648089
4,5-dimethoxy-2-(1H-1,2,4-triazole-5-carbonylamino)benzoic acid (PubChem CID 63648089) has the molecular formula C12H12N4O5 and a molecular weight of 292.25 g/mol. Its IUPAC name is 4,5-dimethoxy-2-(1H-1,2,4-triazole-5-carbonylamino)benzoic acid.
| Compound Name | 4,5-dimethoxy-2-(1H-1,2,4-triazole-5-carbonylamino)benzoic acid |
|---|---|
| PubChem CID | 63648089 |
| Molecular Formula | C12H12N4O5 |
| Molecular Weight | 292.25 g/mol |
| Exact Mass | 292.08 |
| IUPAC Name | 4,5-dimethoxy-2-(1H-1,2,4-triazole-5-carbonylamino)benzoic acid |
| SMILES | COc1cc(NC(=O)c2ncn[nH]2)c(C(=O)O)cc1OC |
| InChI | InChI=1S/C12H12N4O5/c1-20-8-3-6(12(18)19)7(4-9(8)21-2)15-11(17)10-13-5-14-16-10/h3-5H,1-2H3,(H,15,17)(H,18,19)(H,13,14,16) |
| InChIKey | OLVDPJLQLAFWMG-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 126.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.25 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |