C22H27NO8 — CID 16774874
4,5-dimethoxy-2-[(3,4,5-triethoxybenzoyl)amino]benzoic acid (PubChem CID 16774874) has the molecular formula C22H27NO8 and a molecular weight of 433.46 g/mol. Its IUPAC name is 4,5-dimethoxy-2-[(3,4,5-triethoxybenzoyl)amino]benzoic acid.
| Compound Name | 4,5-dimethoxy-2-[(3,4,5-triethoxybenzoyl)amino]benzoic acid |
|---|---|
| PubChem CID | 16774874 |
| Molecular Formula | C22H27NO8 |
| Molecular Weight | 433.46 g/mol |
| Exact Mass | 433.17 |
| IUPAC Name | 4,5-dimethoxy-2-[(3,4,5-triethoxybenzoyl)amino]benzoic acid |
| SMILES | CCOc1cc(C(=O)Nc2cc(OC)c(OC)cc2C(=O)O)cc(OCC)c1OCC |
| InChI | InChI=1S/C22H27NO8/c1-6-29-18-9-13(10-19(30-7-2)20(18)31-8-3)21(24)23-15-12-17(28-5)16(27-4)11-14(15)22(25)26/h9-12H,6-8H2,1-5H3,(H,23,24)(H,25,26) |
| InChIKey | UNNWVDQAHAZAEE-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 112.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.46 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |