C23H19NO7 — CID 17341130
2-[[2-(2-carboxyphenyl)benzoyl]amino]-4,5-dimethoxybenzoic acid (PubChem CID 17341130) has the molecular formula C23H19NO7 and a molecular weight of 421.41 g/mol. Its IUPAC name is 2-[[2-(2-carboxyphenyl)benzoyl]amino]-4,5-dimethoxybenzoic acid.
| Compound Name | 2-[[2-(2-carboxyphenyl)benzoyl]amino]-4,5-dimethoxybenzoic acid |
|---|---|
| PubChem CID | 17341130 |
| Molecular Formula | C23H19NO7 |
| Molecular Weight | 421.41 g/mol |
| Exact Mass | 421.12 |
| IUPAC Name | 2-[[2-(2-carboxyphenyl)benzoyl]amino]-4,5-dimethoxybenzoic acid |
| SMILES | COc1cc(NC(=O)c2ccccc2-c2ccccc2C(=O)O)c(C(=O)O)cc1OC |
| InChI | InChI=1S/C23H19NO7/c1-30-19-11-17(23(28)29)18(12-20(19)31-2)24-21(25)15-9-5-3-7-13(15)14-8-4-6-10-16(14)22(26)27/h3-12H,1-2H3,(H,24,25)(H,26,27)(H,28,29) |
| InChIKey | WKQBLGCKJDYADN-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 122.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.41 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |