C22H19NO5 — CID 1348361
2-[2-[(2,5-dimethoxyphenyl)carbamoyl]phenyl]benzoic acid (PubChem CID 1348361) has the molecular formula C22H19NO5 and a molecular weight of 377.40 g/mol. Its IUPAC name is 2-[2-[(2,5-dimethoxyphenyl)carbamoyl]phenyl]benzoic acid.
| Compound Name | 2-[2-[(2,5-dimethoxyphenyl)carbamoyl]phenyl]benzoic acid |
|---|---|
| PubChem CID | 1348361 |
| Molecular Formula | C22H19NO5 |
| Molecular Weight | 377.40 g/mol |
| Exact Mass | 377.13 |
| IUPAC Name | 2-[2-[(2,5-dimethoxyphenyl)carbamoyl]phenyl]benzoic acid |
| SMILES | COc1ccc(OC)c(NC(=O)c2ccccc2-c2ccccc2C(=O)O)c1 |
| InChI | InChI=1S/C22H19NO5/c1-27-14-11-12-20(28-2)19(13-14)23-21(24)17-9-5-3-7-15(17)16-8-4-6-10-18(16)22(25)26/h3-13H,1-2H3,(H,23,24)(H,25,26) |
| InChIKey | DHVUKQHVUOZGPM-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.40 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |