3-[(2,5-dimethoxyphenyl)carbamoyl]pyrazine-2-carboxylic acid

C14H13N3O5 — CID 20866752

IUPAC3-[(2,5-dimethoxyphenyl)carbamoyl]pyrazine-2-carboxylic acid
SMILESCOc1ccc(OC)c(NC(=O)c2nccnc2C(=O)O)c1
InChIInChI=1S/C14H13N3O5/c1-21-8-3-4-10(22-2)9(7-8)17-13(18)11-12(14(19)20)16-6-5-15-11/h3-7H,1-2H3,(H,17,18)(H,19,20)
InChIKeyLPIGDIWKPNCLFK-UHFFFAOYSA-N
MW303.27 g/mol
LogP1.44
Rot. Bonds5

About 3-[(2,5-dimethoxyphenyl)carbamoyl]pyrazine-2-carboxylic acid

3-[(2,5-dimethoxyphenyl)carbamoyl]pyrazine-2-carboxylic acid (PubChem CID 20866752) has the molecular formula C14H13N3O5 and a molecular weight of 303.27 g/mol. Its IUPAC name is 3-[(2,5-dimethoxyphenyl)carbamoyl]pyrazine-2-carboxylic acid.

Molecular Properties

Compound Name3-[(2,5-dimethoxyphenyl)carbamoyl]pyrazine-2-carboxylic acid
PubChem CID20866752
Molecular FormulaC14H13N3O5
Molecular Weight303.27 g/mol
Exact Mass303.09
IUPAC Name3-[(2,5-dimethoxyphenyl)carbamoyl]pyrazine-2-carboxylic acid
SMILESCOc1ccc(OC)c(NC(=O)c2nccnc2C(=O)O)c1
InChIInChI=1S/C14H13N3O5/c1-21-8-3-4-10(22-2)9(7-8)17-13(18)11-12(14(19)20)16-6-5-15-11/h3-7H,1-2H3,(H,17,18)(H,19,20)
InChIKeyLPIGDIWKPNCLFK-UHFFFAOYSA-N
XLogP1.44
TPSA110.64 Ų
H-Bond Donors2
H-Bond Acceptors6
Rotatable Bonds5
Heavy Atoms22
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500303.27
LogP ≤ 51.44
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 106

Analyze 3-[(2,5-dimethoxyphenyl)carbamoyl]pyrazine-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-[(2,5-dimethoxyphenyl)carbamoyl]pyrazine-2-carboxylic acid?
The IUPAC name of 3-[(2,5-dimethoxyphenyl)carbamoyl]pyrazine-2-carboxylic acid (CID 20866752) is 3-[(2,5-dimethoxyphenyl)carbamoyl]pyrazine-2-carboxylic acid.
What is the SMILES notation for 3-[(2,5-dimethoxyphenyl)carbamoyl]pyrazine-2-carboxylic acid?
The canonical SMILES for 3-[(2,5-dimethoxyphenyl)carbamoyl]pyrazine-2-carboxylic acid is COc1ccc(OC)c(NC(=O)c2nccnc2C(=O)O)c1.
What is the InChIKey of 3-[(2,5-dimethoxyphenyl)carbamoyl]pyrazine-2-carboxylic acid?
The InChIKey is LPIGDIWKPNCLFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13N3O5/c1-21-8-3-4-10(22-2)9(7-8)17-13(18)11-12(14(19)20)16-6-5-15-11/h3-7H,1-2H3,(H,17,18)(H,19,20).
What are the key properties of 3-[(2,5-dimethoxyphenyl)carbamoyl]pyrazine-2-carboxylic acid?
3-[(2,5-dimethoxyphenyl)carbamoyl]pyrazine-2-carboxylic acid has a molecular weight of 303.27 g/mol, XLogP of 1.44, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2,5-dimethoxyphenyl)carbamoyl]pyrazine-2-carboxylic acid is sourced from PubChem (CID 20866752), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).