C18H21NO5 — CID 17355355
N-(2,5-dimethoxyphenyl)-2-(2-methoxyethoxy)benzamide (PubChem CID 17355355) has the molecular formula C18H21NO5 and a molecular weight of 331.37 g/mol. Its IUPAC name is N-(2,5-dimethoxyphenyl)-2-(2-methoxyethoxy)benzamide.
| Compound Name | N-(2,5-dimethoxyphenyl)-2-(2-methoxyethoxy)benzamide |
|---|---|
| PubChem CID | 17355355 |
| Molecular Formula | C18H21NO5 |
| Molecular Weight | 331.37 g/mol |
| Exact Mass | 331.14 |
| IUPAC Name | N-(2,5-dimethoxyphenyl)-2-(2-methoxyethoxy)benzamide |
| SMILES | COCCOc1ccccc1C(=O)Nc1cc(OC)ccc1OC |
| InChI | InChI=1S/C18H21NO5/c1-21-10-11-24-16-7-5-4-6-14(16)18(20)19-15-12-13(22-2)8-9-17(15)23-3/h4-9,12H,10-11H2,1-3H3,(H,19,20) |
| InChIKey | CQYQXSFZZVAISW-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.37 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|