C26H28N2O5 — CID 69361719
2-butoxy-4-methoxy-N-[2-[(2-methoxyphenyl)carbamoyl]phenyl]benzamide (PubChem CID 69361719) has the molecular formula C26H28N2O5 and a molecular weight of 448.52 g/mol. Its IUPAC name is 2-butoxy-4-methoxy-N-[2-[(2-methoxyphenyl)carbamoyl]phenyl]benzamide.
| Compound Name | 2-butoxy-4-methoxy-N-[2-[(2-methoxyphenyl)carbamoyl]phenyl]benzamide |
|---|---|
| PubChem CID | 69361719 |
| Molecular Formula | C26H28N2O5 |
| Molecular Weight | 448.52 g/mol |
| Exact Mass | 448.20 |
| IUPAC Name | 2-butoxy-4-methoxy-N-[2-[(2-methoxyphenyl)carbamoyl]phenyl]benzamide |
| SMILES | CCCCOc1cc(OC)ccc1C(=O)Nc1ccccc1C(=O)Nc1ccccc1OC |
| InChI | InChI=1S/C26H28N2O5/c1-4-5-16-33-24-17-18(31-2)14-15-20(24)26(30)27-21-11-7-6-10-19(21)25(29)28-22-12-8-9-13-23(22)32-3/h6-15,17H,4-5,16H2,1-3H3,(H,27,30)(H,28,29) |
| InChIKey | LQWNTNXZCNHZMA-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.52 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|