C18H19NO5 — CID 5149682
ethyl 2-[(2,4-dimethoxybenzoyl)amino]benzoate (PubChem CID 5149682) has the molecular formula C18H19NO5 and a molecular weight of 329.35 g/mol. Its IUPAC name is ethyl 2-[(2,4-dimethoxybenzoyl)amino]benzoate.
| Compound Name | ethyl 2-[(2,4-dimethoxybenzoyl)amino]benzoate |
|---|---|
| PubChem CID | 5149682 |
| Molecular Formula | C18H19NO5 |
| Molecular Weight | 329.35 g/mol |
| Exact Mass | 329.13 |
| IUPAC Name | ethyl 2-[(2,4-dimethoxybenzoyl)amino]benzoate |
| SMILES | CCOC(=O)c1ccccc1NC(=O)c1ccc(OC)cc1OC |
| InChI | InChI=1S/C18H19NO5/c1-4-24-18(21)13-7-5-6-8-15(13)19-17(20)14-10-9-12(22-2)11-16(14)23-3/h5-11H,4H2,1-3H3,(H,19,20) |
| InChIKey | OCEBKJIZMWAWIF-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.35 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |