C19H16BrNO3 — CID 1369979
5-bromo-N-(2,5-dimethoxyphenyl)naphthalene-1-carboxamide (PubChem CID 1369979) has the molecular formula C19H16BrNO3 and a molecular weight of 386.25 g/mol. Its IUPAC name is 5-bromo-N-(2,5-dimethoxyphenyl)naphthalene-1-carboxamide.
| Compound Name | 5-bromo-N-(2,5-dimethoxyphenyl)naphthalene-1-carboxamide |
|---|---|
| PubChem CID | 1369979 |
| Molecular Formula | C19H16BrNO3 |
| Molecular Weight | 386.25 g/mol |
| Exact Mass | 385.03 |
| IUPAC Name | 5-bromo-N-(2,5-dimethoxyphenyl)naphthalene-1-carboxamide |
| SMILES | COc1ccc(OC)c(NC(=O)c2cccc3c(Br)cccc23)c1 |
| InChI | InChI=1S/C19H16BrNO3/c1-23-12-9-10-18(24-2)17(11-12)21-19(22)15-7-3-6-14-13(15)5-4-8-16(14)20/h3-11H,1-2H3,(H,21,22) |
| InChIKey | LCNZVGRSPMFIKL-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.25 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |