C19H16BrNO2 — CID 3491041
5-bromo-N-(2-hydroxy-4,5-dimethylphenyl)naphthalene-1-carboxamide (PubChem CID 3491041) has the molecular formula C19H16BrNO2 and a molecular weight of 370.25 g/mol. Its IUPAC name is 5-bromo-N-(2-hydroxy-4,5-dimethylphenyl)naphthalene-1-carboxamide.
| Compound Name | 5-bromo-N-(2-hydroxy-4,5-dimethylphenyl)naphthalene-1-carboxamide |
|---|---|
| PubChem CID | 3491041 |
| Molecular Formula | C19H16BrNO2 |
| Molecular Weight | 370.25 g/mol |
| Exact Mass | 369.04 |
| IUPAC Name | 5-bromo-N-(2-hydroxy-4,5-dimethylphenyl)naphthalene-1-carboxamide |
| SMILES | Cc1cc(O)c(NC(=O)c2cccc3c(Br)cccc23)cc1C |
| InChI | InChI=1S/C19H16BrNO2/c1-11-9-17(18(22)10-12(11)2)21-19(23)15-7-3-6-14-13(15)5-4-8-16(14)20/h3-10,22H,1-2H3,(H,21,23) |
| InChIKey | NZPYCYHBLKRBKO-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.25 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|