C19H15ClINO — CID 22780345
5-chloro-N-(4-iodo-2,5-dimethylphenyl)naphthalene-1-carboxamide (PubChem CID 22780345) has the molecular formula C19H15ClINO and a molecular weight of 435.69 g/mol. Its IUPAC name is 5-chloro-N-(4-iodo-2,5-dimethylphenyl)naphthalene-1-carboxamide.
| Compound Name | 5-chloro-N-(4-iodo-2,5-dimethylphenyl)naphthalene-1-carboxamide |
|---|---|
| PubChem CID | 22780345 |
| Molecular Formula | C19H15ClINO |
| Molecular Weight | 435.69 g/mol |
| Exact Mass | 434.99 |
| IUPAC Name | 5-chloro-N-(4-iodo-2,5-dimethylphenyl)naphthalene-1-carboxamide |
| SMILES | Cc1cc(NC(=O)c2cccc3c(Cl)cccc23)c(C)cc1I |
| InChI | InChI=1S/C19H15ClINO/c1-11-10-18(12(2)9-17(11)21)22-19(23)15-7-3-6-14-13(15)5-4-8-16(14)20/h3-10H,1-2H3,(H,22,23) |
| InChIKey | BZBQVUZULCKWDV-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.69 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|