C16H14Cl2INO2 — CID 22782458
3,5-dichloro-N-(4-iodo-2,5-dimethylphenyl)-4-methoxybenzamide (PubChem CID 22782458) has the molecular formula C16H14Cl2INO2 and a molecular weight of 450.10 g/mol. Its IUPAC name is 3,5-dichloro-N-(4-iodo-2,5-dimethylphenyl)-4-methoxybenzamide.
| Compound Name | 3,5-dichloro-N-(4-iodo-2,5-dimethylphenyl)-4-methoxybenzamide |
|---|---|
| PubChem CID | 22782458 |
| Molecular Formula | C16H14Cl2INO2 |
| Molecular Weight | 450.10 g/mol |
| Exact Mass | 448.94 |
| IUPAC Name | 3,5-dichloro-N-(4-iodo-2,5-dimethylphenyl)-4-methoxybenzamide |
| SMILES | COc1c(Cl)cc(C(=O)Nc2cc(C)c(I)cc2C)cc1Cl |
| InChI | InChI=1S/C16H14Cl2INO2/c1-8-5-14(9(2)4-13(8)19)20-16(21)10-6-11(17)15(22-3)12(18)7-10/h4-7H,1-3H3,(H,20,21) |
| InChIKey | UEGCAESVIWHMJB-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.10 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|