C16H15ClINO — CID 19630910
3-chloro-N-(4-iodo-2,5-dimethylphenyl)-4-methylbenzamide (PubChem CID 19630910) has the molecular formula C16H15ClINO and a molecular weight of 399.66 g/mol. Its IUPAC name is 3-chloro-N-(4-iodo-2,5-dimethylphenyl)-4-methylbenzamide.
| Compound Name | 3-chloro-N-(4-iodo-2,5-dimethylphenyl)-4-methylbenzamide |
|---|---|
| PubChem CID | 19630910 |
| Molecular Formula | C16H15ClINO |
| Molecular Weight | 399.66 g/mol |
| Exact Mass | 398.99 |
| IUPAC Name | 3-chloro-N-(4-iodo-2,5-dimethylphenyl)-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)Nc2cc(C)c(I)cc2C)cc1Cl |
| InChI | InChI=1S/C16H15ClINO/c1-9-4-5-12(8-13(9)17)16(20)19-15-7-10(2)14(18)6-11(15)3/h4-8H,1-3H3,(H,19,20) |
| InChIKey | CJFCZXSYXBDIQU-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.66 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|