C15H13ClINO2 — CID 103828130
3-chloro-N-(3-hydroxy-2,4-dimethylphenyl)-4-iodobenzamide (PubChem CID 103828130) has the molecular formula C15H13ClINO2 and a molecular weight of 401.63 g/mol. Its IUPAC name is 3-chloro-N-(3-hydroxy-2,4-dimethylphenyl)-4-iodobenzamide.
| Compound Name | 3-chloro-N-(3-hydroxy-2,4-dimethylphenyl)-4-iodobenzamide |
|---|---|
| PubChem CID | 103828130 |
| Molecular Formula | C15H13ClINO2 |
| Molecular Weight | 401.63 g/mol |
| Exact Mass | 400.97 |
| IUPAC Name | 3-chloro-N-(3-hydroxy-2,4-dimethylphenyl)-4-iodobenzamide |
| SMILES | Cc1ccc(NC(=O)c2ccc(I)c(Cl)c2)c(C)c1O |
| InChI | InChI=1S/C15H13ClINO2/c1-8-3-6-13(9(2)14(8)19)18-15(20)10-4-5-12(17)11(16)7-10/h3-7,19H,1-2H3,(H,18,20) |
| InChIKey | FKICXPMOSFKREB-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.63 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|