C13H12INO2S — CID 79692773
N-(3-hydroxy-2,4-dimethylphenyl)-5-iodothiophene-3-carboxamide (PubChem CID 79692773) has the molecular formula C13H12INO2S and a molecular weight of 373.22 g/mol. Its IUPAC name is N-(3-hydroxy-2,4-dimethylphenyl)-5-iodothiophene-3-carboxamide.
| Compound Name | N-(3-hydroxy-2,4-dimethylphenyl)-5-iodothiophene-3-carboxamide |
|---|---|
| PubChem CID | 79692773 |
| Molecular Formula | C13H12INO2S |
| Molecular Weight | 373.22 g/mol |
| Exact Mass | 372.96 |
| IUPAC Name | N-(3-hydroxy-2,4-dimethylphenyl)-5-iodothiophene-3-carboxamide |
| SMILES | Cc1ccc(NC(=O)c2csc(I)c2)c(C)c1O |
| InChI | InChI=1S/C13H12INO2S/c1-7-3-4-10(8(2)12(7)16)15-13(17)9-5-11(14)18-6-9/h3-6,16H,1-2H3,(H,15,17) |
| InChIKey | KBIKVXZBLQVTOV-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.22 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|