C19H16ClNO — CID 2993699
5-chloro-N-(2,6-dimethylphenyl)naphthalene-1-carboxamide (PubChem CID 2993699) has the molecular formula C19H16ClNO and a molecular weight of 309.80 g/mol. Its IUPAC name is 5-chloro-N-(2,6-dimethylphenyl)naphthalene-1-carboxamide.
| Compound Name | 5-chloro-N-(2,6-dimethylphenyl)naphthalene-1-carboxamide |
|---|---|
| PubChem CID | 2993699 |
| Molecular Formula | C19H16ClNO |
| Molecular Weight | 309.80 g/mol |
| Exact Mass | 309.09 |
| IUPAC Name | 5-chloro-N-(2,6-dimethylphenyl)naphthalene-1-carboxamide |
| SMILES | Cc1cccc(C)c1NC(=O)c1cccc2c(Cl)cccc12 |
| InChI | InChI=1S/C19H16ClNO/c1-12-6-3-7-13(2)18(12)21-19(22)16-10-4-9-15-14(16)8-5-11-17(15)20/h3-11H,1-2H3,(H,21,22) |
| InChIKey | RVBHJCLVVDYDGU-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.80 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |