C24H22N2O6 — CID 1428068
2-[[2,5-dimethoxy-4-[(2-phenylacetyl)amino]phenyl]carbamoyl]benzoic acid (PubChem CID 1428068) has the molecular formula C24H22N2O6 and a molecular weight of 434.45 g/mol. Its IUPAC name is 2-[[2,5-dimethoxy-4-[(2-phenylacetyl)amino]phenyl]carbamoyl]benzoic acid.
| Compound Name | 2-[[2,5-dimethoxy-4-[(2-phenylacetyl)amino]phenyl]carbamoyl]benzoic acid |
|---|---|
| PubChem CID | 1428068 |
| Molecular Formula | C24H22N2O6 |
| Molecular Weight | 434.45 g/mol |
| Exact Mass | 434.15 |
| IUPAC Name | 2-[[2,5-dimethoxy-4-[(2-phenylacetyl)amino]phenyl]carbamoyl]benzoic acid |
| SMILES | COc1cc(NC(=O)c2ccccc2C(=O)O)c(OC)cc1NC(=O)Cc1ccccc1 |
| InChI | InChI=1S/C24H22N2O6/c1-31-20-14-19(26-23(28)16-10-6-7-11-17(16)24(29)30)21(32-2)13-18(20)25-22(27)12-15-8-4-3-5-9-15/h3-11,13-14H,12H2,1-2H3,(H,25,27)(H,26,28)(H,29,30) |
| InChIKey | WTVDBEGNYIQEDY-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.45 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |