C16H16ClN3O3 — CID 163846426
2,5-dimethoxy-4-[(2-phenylacetyl)amino]benzenediazonium chloride (PubChem CID 163846426) has the molecular formula C16H16ClN3O3 and a molecular weight of 333.78 g/mol. Its IUPAC name is 2,5-dimethoxy-4-[(2-phenylacetyl)amino]benzenediazonium chloride.
| Compound Name | 2,5-dimethoxy-4-[(2-phenylacetyl)amino]benzenediazonium chloride |
|---|---|
| PubChem CID | 163846426 |
| Molecular Formula | C16H16ClN3O3 |
| Molecular Weight | 333.78 g/mol |
| Exact Mass | 333.09 |
| IUPAC Name | 2,5-dimethoxy-4-[(2-phenylacetyl)amino]benzenediazonium chloride |
| SMILES | COc1cc(NC(=O)Cc2ccccc2)c(OC)cc1[N+]#N.[Cl-] |
| InChI | InChI=1S/C16H15N3O3.ClH/c1-21-14-10-13(19-17)15(22-2)9-12(14)18-16(20)8-11-6-4-3-5-7-11;/h3-7,9-10H,8H2,1-2H3;1H |
| InChIKey | OQOQMZYFIHGZFC-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.78 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Azo_group', 'substructure': 'N/A'} |
|---|